|
Foot-and-Mouth Disease Virus
|
B04.820.578.750.070.250 |
|
|
Aphthovirus
|
B04.820.578.750.070 |
|
|
Hyperhomocysteinemia
|
D020138 |
[Condition in which the plasma levels of homocysteine and related metabolites are elevated (>13.9 μmol/l). Hyperhomocysteinemia can be familial or acquired. Development of the acquired hyperhomocysteinemia is mostly associated with vitamins B and/or folate deficiency (e.g., PERNICIOUS ANEMIA, vitamin malabsorption). Familial hyperhomocysteinemia often results in a more severe elevation of total homocysteine and excretion into the urine, resulting in HOMOCYSTINURIA. Hyperhomocysteinemia is a risk factor for cardiovascular and neurodegenerative diseases, osteoporotic fractures and complications during pregnancy.
] |
|
Gastroschisis
|
D020139 |
[A congenital defect with major fissure in the ABDOMINAL WALL lateral to, but not at, the UMBILICUS. This results in the extrusion of VISCERA. Unlike OMPHALOCELE, herniated structures in gastroschisis are not covered by a sac or PERITONEUM.
] |
|
Receptor, Melanocortin, Type 2
|
D044103 |
[A melanocortin receptor subtype found primarily in the ADRENAL CORTEX. It shows specificity for ADRENOCORTICOTROPIC HORMONE.
] |
|
Hydrogel, Polyethylene Glycol Dimethacrylate
|
D020136 |
[A network of cross-linked hydrophilic macromolecules used in biomedical applications fabricated by photopolymerization of polyethylene glycol dimethacrylate. Its general formulae is C3H5C(O)(OCH2CH2)nOC(O)C3H5 where n denotes a number of average polyglycol (OCH2CH2) repeats.
] |
|
Receptor, Melanocortin, Type 3
|
D044104 |
[A melanocortin receptor subtype found primarily in BRAIN. It shows specificity for ALPHA-MSH; BETA-MSH; GAMMA-MSH and ADRENOCORTICOTROPIC HORMONE.
] |
|
Base Pair Mismatch
|
D020137 |
[The presence of an uncomplimentary base in double-stranded DNA caused by spontaneous deamination of cytosine or adenine, mismatching during homologous recombination, or errors in DNA replication. Multiple, sequential base pair mismatches lead to formation of heteroduplex DNA; (NUCLEIC ACID HETERODUPLEXES).
] |
|
Receptor, Melanocortin, Type 4
|
D044105 |
[A melanocortin receptor subtype found primarily in BRAIN. It shows specificity for ALPHA-MSH; BETA-MSH and ADRENOCORTICOTROPIC HORMONE.
] |
|
Live Birth
|
G08.686.784.769.496.249 |
|
|
Catalytic Domain
|
D020134 |
[The region of an enzyme that interacts with its substrate to cause the enzymatic reaction.
] |
|
Nephropidae
|
B01.050.500.131.365.190.550 |
|
|
Wigglesworthia
|
D044106 |
[A genus of gram-negative, rod-shaped bacteria in the family ENTEROBACTERIACEAE. They exist only as primary endosymbionts of five species of TSETSE FLIES, found in specialized organelles called mycetomes. The bacteria supply crucial B vitamins (VITAMIN B COMPLEX) which the flies require for fertility.
] |
|
Peptide Nucleic Acids
|
D020135 |
[DNA analogs containing neutral amide backbone linkages composed of aminoethyl glycine units instead of the usual phosphodiester linkage of deoxyribose groups. Peptide nucleic acids have high biological stability and higher affinity for complementary DNA or RNA sequences than analogous DNA oligomers.
] |
|
Patient Health Questionnaire
|
E05.318.308.980.493 |
|
|
Language Development Disorders
|
C23.888.592.604.150.500.550 |
|
|
Pain Perception
|
D058748 |
[The process by which PAIN is recognized and interpreted by the brain.
] |
|
Military Facilities
|
D058749 |
[Areas designated for use by the armed forces personnel.
] |
|
Radioactive Waste
|
D27.888.426.500.638 |
|
|
Hazardous Waste
|
D27.888.426.500 |
|
